C32H44O6 — CID 138566498
4-O-[2-[4-[2-[4-(5-ethylheptan-2-yloxy)phenyl]propan-2-yl]phenoxy]propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 138566498) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is 4-O-[2-[4-[2-[4-(5-ethylheptan-2-yloxy)phenyl]propan-2-yl]phenoxy]propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[4-[2-[4-(5-ethylheptan-2-yloxy)phenyl]propan-2-yl]phenoxy]propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 138566498 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 4-O-[2-[4-[2-[4-(5-ethylheptan-2-yloxy)phenyl]propan-2-yl]phenoxy]propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | CCC(CC)CCC(C)Oc1ccc(C(C)(C)c2ccc(OC(C)COC(=O)/C=C/C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C32H44O6/c1-8-25(9-2)11-10-23(3)37-28-16-12-26(13-17-28)32(5,6)27-14-18-29(19-15-27)38-24(4)22-36-31(34)21-20-30(33)35-7/h12-21,23-25H,8-11,22H2,1-7H3/b21-20+ |
| InChIKey | VAUHMDWVMLNMOB-QZQOTICOSA-N |
| XLogP | 7.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|