About [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate
[4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate (PubChem CID 130222536) has the molecular formula C26H36O3
and a molecular weight of 396.57 g/mol. Its IUPAC name is [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate.
Molecular Properties
| Compound Name | [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate |
| PubChem CID | 130222536 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate |
| SMILES | CCC(CC)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C26H36O3/c1-7-19(8-2)25(27)29-24-17-13-21(14-18-24)26(5,6)20-11-15-23(16-12-20)28-22(9-3)10-4/h11-19,22H,7-10H2,1-6H3 |
| InChIKey | HKEJOQGMZOJVSD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate?
The IUPAC name of [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate (CID 130222536) is [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate.
What is the SMILES notation for [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate?
The canonical SMILES for [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate is CCC(CC)Oc1ccc(C(C)(C)c2ccc(OC(=O)C(CC)CC)cc2)cc1.
What is the InChIKey of [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate?
The InChIKey is HKEJOQGMZOJVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36O3/c1-7-19(8-2)25(27)29-24-17-13-21(14-18-24)26(5,6)20-11-15-23(16-12-20)28-22(9-3)10-4/h11-19,22H,7-10H2,1-6H3.
What are the key properties of [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate?
[4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate has a molecular weight of 396.57 g/mol, XLogP of 6.92, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-pentan-3-yloxyphenyl)propan-2-yl]phenyl] 2-ethylbutanoate is sourced from PubChem (CID 130222536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).