About [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate
[4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate (PubChem CID 89264578) has the molecular formula C25H34O4
and a molecular weight of 398.54 g/mol. Its IUPAC name is [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate.
Molecular Properties
| Compound Name | [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate |
| PubChem CID | 89264578 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate |
| SMILES | CCCC(CC)C(=O)Oc1ccc(Oc2ccc(OC(C)(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C25H34O4/c1-6-10-19(7-2)24(26)28-22-13-11-20(12-14-22)27-21-15-17-23(18-16-21)29-25(5,8-3)9-4/h11-19H,6-10H2,1-5H3 |
| InChIKey | OJJTUJLJJUYHLM-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate?
The IUPAC name of [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate (CID 89264578) is [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate.
What is the SMILES notation for [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate?
The canonical SMILES for [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate is CCCC(CC)C(=O)Oc1ccc(Oc2ccc(OC(C)(CC)CC)cc2)cc1.
What is the InChIKey of [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate?
The InChIKey is OJJTUJLJJUYHLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O4/c1-6-10-19(7-2)24(26)28-22-13-11-20(12-14-22)27-21-15-17-23(18-16-21)29-25(5,8-3)9-4/h11-19H,6-10H2,1-5H3.
What are the key properties of [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate?
[4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate has a molecular weight of 398.54 g/mol, XLogP of 7.17, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3-methylpentan-3-yloxy)phenoxy]phenyl] 2-ethylpentanoate is sourced from PubChem (CID 89264578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).