C38H37O6S+ — CID 163489194
2,8-bis[4-(1-ethoxyethoxy)phenoxy]-5-phenyldibenzothiophen-5-ium (PubChem CID 163489194) has the molecular formula C38H37O6S+ and a molecular weight of 621.77 g/mol. Its IUPAC name is 2,8-bis[4-(1-ethoxyethoxy)phenoxy]-5-phenyldibenzothiophen-5-ium.
| Compound Name | 2,8-bis[4-(1-ethoxyethoxy)phenoxy]-5-phenyldibenzothiophen-5-ium |
|---|---|
| PubChem CID | 163489194 |
| Molecular Formula | C38H37O6S+ |
| Molecular Weight | 621.77 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 2,8-bis[4-(1-ethoxyethoxy)phenoxy]-5-phenyldibenzothiophen-5-ium |
| SMILES | CCOC(C)Oc1ccc(Oc2ccc3c(c2)c2cc(Oc4ccc(OC(C)OCC)cc4)ccc2[s+]3-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H37O6S/c1-5-39-26(3)41-28-12-16-30(17-13-28)43-32-20-22-37-35(24-32)36-25-33(21-23-38(36)45(37)34-10-8-7-9-11-34)44-31-18-14-29(15-19-31)42-27(4)40-6-2/h7-27H,5-6H2,1-4H3/q+1 |
| InChIKey | CLCOWGPLZBWESY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.77 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|