C25H17I2OS+ — CID 166037510
5-[4-[(3,4-diiodophenyl)methoxy]phenyl]dibenzothiophen-5-ium (PubChem CID 166037510) has the molecular formula C25H17I2OS+ and a molecular weight of 619.29 g/mol. Its IUPAC name is 5-[4-[(3,4-diiodophenyl)methoxy]phenyl]dibenzothiophen-5-ium.
| Compound Name | 5-[4-[(3,4-diiodophenyl)methoxy]phenyl]dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 166037510 |
| Molecular Formula | C25H17I2OS+ |
| Molecular Weight | 619.29 g/mol |
| Exact Mass | 618.91 |
| IUPAC Name | 5-[4-[(3,4-diiodophenyl)methoxy]phenyl]dibenzothiophen-5-ium |
| SMILES | Ic1ccc(COc2ccc(-[s+]3c4ccccc4c4ccccc43)cc2)cc1I |
| InChI | InChI=1S/C25H17I2OS/c26-22-14-9-17(15-23(22)27)16-28-18-10-12-19(13-11-18)29-24-7-3-1-5-20(24)21-6-2-4-8-25(21)29/h1-15H,16H2/q+1 |
| InChIKey | LSDSTUZJOBKNRB-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.29 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|