About 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium
5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium (PubChem CID 163749688) has the molecular formula C29H22F3OS+
and a molecular weight of 475.56 g/mol. Its IUPAC name is 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium.
Molecular Properties
| Compound Name | 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium |
| PubChem CID | 163749688 |
| Molecular Formula | C29H22F3OS+ |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium |
| SMILES | C=CC(c1ccc(OCC(F)(F)F)cc1)c1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C29H22F3OS/c1-2-24(20-11-15-22(16-12-20)33-19-29(30,31)32)21-13-17-23(18-14-21)34-27-9-5-3-7-25(27)26-8-4-6-10-28(26)34/h2-18,24H,1,19H2/q+1 |
| InChIKey | LOYDOQNHXAYTRO-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium?
The IUPAC name of 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium (CID 163749688) is 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium.
What is the SMILES notation for 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium?
The canonical SMILES for 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium is C=CC(c1ccc(OCC(F)(F)F)cc1)c1ccc(-[s+]2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium?
The InChIKey is LOYDOQNHXAYTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22F3OS/c1-2-24(20-11-15-22(16-12-20)33-19-29(30,31)32)21-13-17-23(18-14-21)34-27-9-5-3-7-25(27)26-8-4-6-10-28(26)34/h2-18,24H,1,19H2/q+1.
What are the key properties of 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium?
5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium has a molecular weight of 475.56 g/mol, XLogP of 8.99, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[1-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enyl]phenyl]dibenzothiophen-5-ium is sourced from PubChem (CID 163749688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).