C30H19F18O6S+ — CID 165169524
2-[[4-[2,8-bis[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]dibenzothiophen-5-ium-5-yl]phenoxy]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 165169524) has the molecular formula C30H19F18O6S+ and a molecular weight of 849.51 g/mol. Its IUPAC name is 2-[[4-[2,8-bis[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]dibenzothiophen-5-ium-5-yl]phenoxy]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[4-[2,8-bis[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]dibenzothiophen-5-ium-5-yl]phenoxy]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 165169524 |
| Molecular Formula | C30H19F18O6S+ |
| Molecular Weight | 849.51 g/mol |
| Exact Mass | 849.06 |
| IUPAC Name | 2-[[4-[2,8-bis[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]dibenzothiophen-5-ium-5-yl]phenoxy]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(COc1ccc(-[s+]2c3ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc3c3cc(OCC(O)(C(F)(F)F)C(F)(F)F)ccc32)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C30H19F18O6S/c31-25(32,33)22(49,26(34,35)36)11-52-14-1-5-17(6-2-14)55-20-7-3-15(53-12-23(50,27(37,38)39)28(40,41)42)9-18(20)19-10-16(4-8-21(19)55)54-13-24(51,29(43,44)45)30(46,47)48/h1-10,49-51H,11-13H2/q+1 |
| InChIKey | CDBOLKPTUFHICP-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.51 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|