C26H18F12O4S — CID 165169516
1,1,1,3,3,3-hexafluoro-2-[[4-[2-phenyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanylphenoxy]methyl]propan-2-ol (PubChem CID 165169516) has the molecular formula C26H18F12O4S and a molecular weight of 654.47 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[4-[2-phenyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanylphenoxy]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[4-[2-phenyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanylphenoxy]methyl]propan-2-ol |
|---|---|
| PubChem CID | 165169516 |
| Molecular Formula | C26H18F12O4S |
| Molecular Weight | 654.47 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[4-[2-phenyl-4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanylphenoxy]methyl]propan-2-ol |
| SMILES | OC(COc1ccc(Sc2ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc2-c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H18F12O4S/c27-23(28,29)21(39,24(30,31)32)13-41-16-6-9-18(10-7-16)43-20-11-8-17(12-19(20)15-4-2-1-3-5-15)42-14-22(40,25(33,34)35)26(36,37)38/h1-12,39-40H,13-14H2 |
| InChIKey | XAPBOAJWDMKATH-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.47 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |