C15H17F6O2S+ — CID 140915978
1,1,1,3,3,3-hexafluoro-2-[[4-(thian-1-ium-1-yl)phenoxy]methyl]propan-2-ol (PubChem CID 140915978) has the molecular formula C15H17F6O2S+ and a molecular weight of 375.35 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[4-(thian-1-ium-1-yl)phenoxy]methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[4-(thian-1-ium-1-yl)phenoxy]methyl]propan-2-ol |
|---|---|
| PubChem CID | 140915978 |
| Molecular Formula | C15H17F6O2S+ |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[4-(thian-1-ium-1-yl)phenoxy]methyl]propan-2-ol |
| SMILES | OC(COc1ccc([S+]2CCCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F6O2S/c16-14(17,18)13(22,15(19,20)21)10-23-11-4-6-12(7-5-11)24-8-2-1-3-9-24/h4-7,22H,1-3,8-10H2/q+1 |
| InChIKey | SDMGEQIQNTVXHP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|