C32H18F6O2S2 — CID 139989888
[2-fluoro-6-[4-[5-methoxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethanone (PubChem CID 139989888) has the molecular formula C32H18F6O2S2 and a molecular weight of 612.62 g/mol. Its IUPAC name is [2-fluoro-6-[4-[5-methoxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethanone.
| Compound Name | [2-fluoro-6-[4-[5-methoxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 139989888 |
| Molecular Formula | C32H18F6O2S2 |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | [2-fluoro-6-[4-[5-methoxy-2-(2,3,4,5,6-pentafluorophenyl)sulfanylphenyl]phenyl]sulfanylphenyl]-phenylmethanone |
| SMILES | COc1ccc(Sc2c(F)c(F)c(F)c(F)c2F)c(-c2ccc(Sc3cccc(F)c3C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H18F6O2S2/c1-40-19-12-15-23(42-32-29(37)27(35)26(34)28(36)30(32)38)21(16-19)17-10-13-20(14-11-17)41-24-9-5-8-22(33)25(24)31(39)18-6-3-2-4-7-18/h2-16H,1H3 |
| InChIKey | MEKBOPLIDHVNFC-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|