C14H9F5O2S — CID 15536075
1-(2,5-dimethoxyphenyl)sulfanyl-2,3,4,5,6-pentafluorobenzene (PubChem CID 15536075) has the molecular formula C14H9F5O2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfanyl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfanyl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 15536075 |
| Molecular Formula | C14H9F5O2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfanyl-2,3,4,5,6-pentafluorobenzene |
| SMILES | COc1ccc(OC)c(Sc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H9F5O2S/c1-20-6-3-4-7(21-2)8(5-6)22-14-12(18)10(16)9(15)11(17)13(14)19/h3-5H,1-2H3 |
| InChIKey | OBICSEVYWAHPHS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|