C14H6F8O2 — CID 134630267
1,2,3,4,5-pentafluoro-6-[5-methoxy-2-(trifluoromethoxy)phenyl]benzene (PubChem CID 134630267) has the molecular formula C14H6F8O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[5-methoxy-2-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[5-methoxy-2-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 134630267 |
| Molecular Formula | C14H6F8O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[5-methoxy-2-(trifluoromethoxy)phenyl]benzene |
| SMILES | COc1ccc(OC(F)(F)F)c(-c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H6F8O2/c1-23-5-2-3-7(24-14(20,21)22)6(4-5)8-9(15)11(17)13(19)12(18)10(8)16/h2-4H,1H3 |
| InChIKey | SGSUCECNKYOOTQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|