C13H6F5O4S- — CID 57363236
4-methoxy-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonate (PubChem CID 57363236) has the molecular formula C13H6F5O4S- and a molecular weight of 353.24 g/mol. Its IUPAC name is 4-methoxy-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonate.
| Compound Name | 4-methoxy-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonate |
|---|---|
| PubChem CID | 57363236 |
| Molecular Formula | C13H6F5O4S- |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4-methoxy-2-(2,3,4,5,6-pentafluorophenyl)benzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)[O-])c(-c2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C13H7F5O4S/c1-22-5-2-3-7(23(19,20)21)6(4-5)8-9(14)11(16)13(18)12(17)10(8)15/h2-4H,1H3,(H,19,20,21)/p-1 |
| InChIKey | JFZNBCOGUPGPQX-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|