C7H8ClFO4S — CID 174836011
2-fluoro-4-methoxybenzenesulfonic acid;hydrochloride (PubChem CID 174836011) has the molecular formula C7H8ClFO4S and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-fluoro-4-methoxybenzenesulfonic acid;hydrochloride.
| Compound Name | 2-fluoro-4-methoxybenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174836011 |
| Molecular Formula | C7H8ClFO4S |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 2-fluoro-4-methoxybenzenesulfonic acid;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)O)c(F)c1.Cl |
| InChI | InChI=1S/C7H7FO4S.ClH/c1-12-5-2-3-7(6(8)4-5)13(9,10)11;/h2-4H,1H3,(H,9,10,11);1H |
| InChIKey | QZXZVKHZIXNJQI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|