C13H12FNO6S2 — CID 172763228
2-fluoro-5-(4-methoxyphenyl)-3-sulfamoylbenzenesulfonic acid (PubChem CID 172763228) has the molecular formula C13H12FNO6S2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-fluoro-5-(4-methoxyphenyl)-3-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-fluoro-5-(4-methoxyphenyl)-3-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 172763228 |
| Molecular Formula | C13H12FNO6S2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2-fluoro-5-(4-methoxyphenyl)-3-sulfamoylbenzenesulfonic acid |
| SMILES | COc1ccc(-c2cc(S(N)(=O)=O)c(F)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C13H12FNO6S2/c1-21-10-4-2-8(3-5-10)9-6-11(22(15,16)17)13(14)12(7-9)23(18,19)20/h2-7H,1H3,(H2,15,16,17)(H,18,19,20) |
| InChIKey | LYYIDBOQYVFNMI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|