C8H11NO4S — CID 67168933
2-(hydroxymethyl)-4-methoxybenzenesulfonamide (PubChem CID 67168933) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-methoxybenzenesulfonamide.
| Compound Name | 2-(hydroxymethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 67168933 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 2-(hydroxymethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)c(CO)c1 |
| InChI | InChI=1S/C8H11NO4S/c1-13-7-2-3-8(14(9,11)12)6(4-7)5-10/h2-4,10H,5H2,1H3,(H2,9,11,12) |
| InChIKey | GBFCUMPHLPPILK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |