C17H19BrO5S — CID 157270721
[5-bromo-2-[2-(2,4-dimethoxyphenyl)ethylsulfonyl]phenyl]methanol (PubChem CID 157270721) has the molecular formula C17H19BrO5S and a molecular weight of 415.31 g/mol. Its IUPAC name is [5-bromo-2-[2-(2,4-dimethoxyphenyl)ethylsulfonyl]phenyl]methanol.
| Compound Name | [5-bromo-2-[2-(2,4-dimethoxyphenyl)ethylsulfonyl]phenyl]methanol |
|---|---|
| PubChem CID | 157270721 |
| Molecular Formula | C17H19BrO5S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [5-bromo-2-[2-(2,4-dimethoxyphenyl)ethylsulfonyl]phenyl]methanol |
| SMILES | COc1ccc(CCS(=O)(=O)c2ccc(Br)cc2CO)c(OC)c1 |
| InChI | InChI=1S/C17H19BrO5S/c1-22-15-5-3-12(16(10-15)23-2)7-8-24(20,21)17-6-4-14(18)9-13(17)11-19/h3-6,9-10,19H,7-8,11H2,1-2H3 |
| InChIKey | LCXQLWPCAOVVSR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |