C13H14N2O5S — CID 79084888
2-[5-methoxy-2-(pyrrol-1-ylsulfamoyl)phenyl]acetic acid (PubChem CID 79084888) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[5-methoxy-2-(pyrrol-1-ylsulfamoyl)phenyl]acetic acid.
| Compound Name | 2-[5-methoxy-2-(pyrrol-1-ylsulfamoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 79084888 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-[5-methoxy-2-(pyrrol-1-ylsulfamoyl)phenyl]acetic acid |
| SMILES | COc1ccc(S(=O)(=O)Nn2cccc2)c(CC(=O)O)c1 |
| InChI | InChI=1S/C13H14N2O5S/c1-20-11-4-5-12(10(8-11)9-13(16)17)21(18,19)14-15-6-2-3-7-15/h2-8,14H,9H2,1H3,(H,16,17) |
| InChIKey | SAEXNRIWLGLMFG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |