C14H13NaO5S — CID 112758476
sodium 5-methoxy-2-phenylmethoxybenzenesulfonate (PubChem CID 112758476) has the molecular formula C14H13NaO5S and a molecular weight of 316.31 g/mol. Its IUPAC name is sodium 5-methoxy-2-phenylmethoxybenzenesulfonate.
| Compound Name | sodium 5-methoxy-2-phenylmethoxybenzenesulfonate |
|---|---|
| PubChem CID | 112758476 |
| Molecular Formula | C14H13NaO5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | sodium 5-methoxy-2-phenylmethoxybenzenesulfonate |
| SMILES | COc1ccc(OCc2ccccc2)c(S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C14H14O5S.Na/c1-18-12-7-8-13(14(9-12)20(15,16)17)19-10-11-5-3-2-4-6-11;/h2-9H,10H2,1H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | CGVQMYGVPHTQDZ-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|