C10H11O4S- — CID 6928078
2-(2,5-dimethoxyphenyl)sulfanylacetate (PubChem CID 6928078) has the molecular formula C10H11O4S- and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)sulfanylacetate.
| Compound Name | 2-(2,5-dimethoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 6928078 |
| Molecular Formula | C10H11O4S- |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)sulfanylacetate |
| SMILES | COc1ccc(OC)c(SCC(=O)[O-])c1 |
| InChI | InChI=1S/C10H12O4S/c1-13-7-3-4-8(14-2)9(5-7)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| InChIKey | WLMYLHHXANUZIH-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |