C11H12NO4S- — CID 6927748
2-(2-carbamoyl-5-ethoxyphenyl)sulfanylacetate (PubChem CID 6927748) has the molecular formula C11H12NO4S- and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(2-carbamoyl-5-ethoxyphenyl)sulfanylacetate.
| Compound Name | 2-(2-carbamoyl-5-ethoxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 6927748 |
| Molecular Formula | C11H12NO4S- |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(2-carbamoyl-5-ethoxyphenyl)sulfanylacetate |
| SMILES | CCOc1ccc(C(N)=O)c(SCC(=O)[O-])c1 |
| InChI | InChI=1S/C11H13NO4S/c1-2-16-7-3-4-8(11(12)15)9(5-7)17-6-10(13)14/h3-5H,2,6H2,1H3,(H2,12,15)(H,13,14)/p-1 |
| InChIKey | XETNLDWLMNXRIA-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |