C12H15NO5 — CID 27282127
(3R)-3-azaniumyl-4-(2,4-dimethoxyphenyl)-4-oxobutanoate (PubChem CID 27282127) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (3R)-3-azaniumyl-4-(2,4-dimethoxyphenyl)-4-oxobutanoate.
| Compound Name | (3R)-3-azaniumyl-4-(2,4-dimethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 27282127 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (3R)-3-azaniumyl-4-(2,4-dimethoxyphenyl)-4-oxobutanoate |
| SMILES | COc1ccc(C(=O)[C@H]([NH3+])CC(=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C12H15NO5/c1-17-7-3-4-8(10(5-7)18-2)12(16)9(13)6-11(14)15/h3-5,9H,6,13H2,1-2H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | NYDOZLVLASCQRQ-SECBINFHSA-N |
| XLogP | -1.36 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |