C17H16NO5S- — CID 7335677
2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 7335677) has the molecular formula C17H16NO5S- and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | 2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7335677 |
| Molecular Formula | C17H16NO5S- |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2ccccc2C(=O)[O-])c1 |
| InChI | InChI=1S/C17H17NO5S/c1-22-11-7-8-14(23-2)13(9-11)18-16(19)10-24-15-6-4-3-5-12(15)17(20)21/h3-9H,10H2,1-2H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | NNANACFVCLKXNB-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |