C13H20O4S2 — CID 102497342
2-[(2,4-dimethoxyphenyl)-(2-hydroxyethylsulfanyl)methyl]sulfanylethanol (PubChem CID 102497342) has the molecular formula C13H20O4S2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)-(2-hydroxyethylsulfanyl)methyl]sulfanylethanol.
| Compound Name | 2-[(2,4-dimethoxyphenyl)-(2-hydroxyethylsulfanyl)methyl]sulfanylethanol |
|---|---|
| PubChem CID | 102497342 |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)-(2-hydroxyethylsulfanyl)methyl]sulfanylethanol |
| SMILES | COc1ccc(C(SCCO)SCCO)c(OC)c1 |
| InChI | InChI=1S/C13H20O4S2/c1-16-10-3-4-11(12(9-10)17-2)13(18-7-5-14)19-8-6-15/h3-4,9,13-15H,5-8H2,1-2H3 |
| InChIKey | WXZKUMWFBOQLPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|