C14H24N2O3 — CID 83176320
3-[[2-amino-1-(2,4-dimethoxyphenyl)ethyl]amino]butan-1-ol (PubChem CID 83176320) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[[2-amino-1-(2,4-dimethoxyphenyl)ethyl]amino]butan-1-ol.
| Compound Name | 3-[[2-amino-1-(2,4-dimethoxyphenyl)ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83176320 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-[[2-amino-1-(2,4-dimethoxyphenyl)ethyl]amino]butan-1-ol |
| SMILES | COc1ccc(C(CN)NC(C)CCO)c(OC)c1 |
| InChI | InChI=1S/C14H24N2O3/c1-10(6-7-17)16-13(9-15)12-5-4-11(18-2)8-14(12)19-3/h4-5,8,10,13,16-17H,6-7,9,15H2,1-3H3 |
| InChIKey | MNGKITKSFCGPPR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |