C13H21BrN2O2 — CID 114077715
3-[[2-amino-1-(2-bromo-5-methoxyphenyl)ethyl]amino]butan-1-ol (PubChem CID 114077715) has the molecular formula C13H21BrN2O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-[[2-amino-1-(2-bromo-5-methoxyphenyl)ethyl]amino]butan-1-ol.
| Compound Name | 3-[[2-amino-1-(2-bromo-5-methoxyphenyl)ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 114077715 |
| Molecular Formula | C13H21BrN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[[2-amino-1-(2-bromo-5-methoxyphenyl)ethyl]amino]butan-1-ol |
| SMILES | COc1ccc(Br)c(C(CN)NC(C)CCO)c1 |
| InChI | InChI=1S/C13H21BrN2O2/c1-9(5-6-17)16-13(8-15)11-7-10(18-2)3-4-12(11)14/h3-4,7,9,13,16-17H,5-6,8,15H2,1-2H3 |
| InChIKey | CXKHHQRYLUQNTO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |