C13H18N2O2 — CID 65381166
1-(2,4-dimethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 65381166) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 65381166 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H18N2O2/c1-4-7-15-12(9-14)11-6-5-10(16-2)8-13(11)17-3/h1,5-6,8,12,15H,7,9,14H2,2-3H3 |
| InChIKey | NIXCRRMUKGWIEL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|