C11H14N2O2 — CID 105315555
1-(2,4-dimethoxyphenyl)prop-2-ynylhydrazine (PubChem CID 105315555) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)prop-2-ynylhydrazine.
| Compound Name | 1-(2,4-dimethoxyphenyl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105315555 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C11H14N2O2/c1-4-10(13-12)9-6-5-8(14-2)7-11(9)15-3/h1,5-7,10,13H,12H2,2-3H3 |
| InChIKey | MVLHGUSCUWCQCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|