C13H18N2O2 — CID 43151527
2-(2,4-dimethoxyphenyl)-2-(propan-2-ylamino)acetonitrile (PubChem CID 43151527) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-2-(propan-2-ylamino)acetonitrile.
| Compound Name | 2-(2,4-dimethoxyphenyl)-2-(propan-2-ylamino)acetonitrile |
|---|---|
| PubChem CID | 43151527 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-2-(propan-2-ylamino)acetonitrile |
| SMILES | COc1ccc(C(C#N)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(2)15-12(8-14)11-6-5-10(16-3)7-13(11)17-4/h5-7,9,12,15H,1-4H3 |
| InChIKey | GLCCRMFSURESEJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |