C16H19IN2O2 — CID 105310306
[1-(2,4-dimethoxyphenyl)-2-(4-iodophenyl)ethyl]hydrazine (PubChem CID 105310306) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is [1-(2,4-dimethoxyphenyl)-2-(4-iodophenyl)ethyl]hydrazine.
| Compound Name | [1-(2,4-dimethoxyphenyl)-2-(4-iodophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105310306 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [1-(2,4-dimethoxyphenyl)-2-(4-iodophenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(Cc2ccc(I)cc2)NN)c(OC)c1 |
| InChI | InChI=1S/C16H19IN2O2/c1-20-13-7-8-14(16(10-13)21-2)15(19-18)9-11-3-5-12(17)6-4-11/h3-8,10,15,19H,9,18H2,1-2H3 |
| InChIKey | AVHYUAROHDYJDC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|