C14H22N2O2 — CID 105311306
1-(2,4-dimethoxyphenyl)hex-5-enylhydrazine (PubChem CID 105311306) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)hex-5-enylhydrazine.
| Compound Name | 1-(2,4-dimethoxyphenyl)hex-5-enylhydrazine |
|---|---|
| PubChem CID | 105311306 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)hex-5-enylhydrazine |
| SMILES | C=CCCCC(NN)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H22N2O2/c1-4-5-6-7-13(16-15)12-9-8-11(17-2)10-14(12)18-3/h4,8-10,13,16H,1,5-7,15H2,2-3H3 |
| InChIKey | PSSJBHXEENUOJD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|