C13H21NO3 — CID 116952940
4-(2,4-dimethoxyphenyl)-4-(methylamino)butan-1-ol (PubChem CID 116952940) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-4-(methylamino)butan-1-ol.
| Compound Name | 4-(2,4-dimethoxyphenyl)-4-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 116952940 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-4-(methylamino)butan-1-ol |
| SMILES | CNC(CCCO)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H21NO3/c1-14-12(5-4-8-15)11-7-6-10(16-2)9-13(11)17-3/h6-7,9,12,14-15H,4-5,8H2,1-3H3 |
| InChIKey | IYQQLKPJGDCZKC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |