C20H16I2O2 — CID 54243876
2,6-diiodo-4-[(4-phenylmethoxyphenyl)methyl]phenol (PubChem CID 54243876) has the molecular formula C20H16I2O2 and a molecular weight of 542.15 g/mol. Its IUPAC name is 2,6-diiodo-4-[(4-phenylmethoxyphenyl)methyl]phenol.
| Compound Name | 2,6-diiodo-4-[(4-phenylmethoxyphenyl)methyl]phenol |
|---|---|
| PubChem CID | 54243876 |
| Molecular Formula | C20H16I2O2 |
| Molecular Weight | 542.15 g/mol |
| Exact Mass | 541.92 |
| IUPAC Name | 2,6-diiodo-4-[(4-phenylmethoxyphenyl)methyl]phenol |
| SMILES | Oc1c(I)cc(Cc2ccc(OCc3ccccc3)cc2)cc1I |
| InChI | InChI=1S/C20H16I2O2/c21-18-11-16(12-19(22)20(18)23)10-14-6-8-17(9-7-14)24-13-15-4-2-1-3-5-15/h1-9,11-12,23H,10,13H2 |
| InChIKey | QRWSCOGKZXMBFA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.15 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|