C25H17I2O2S+ — CID 166037499
2-[(4-dibenzothiophen-5-ium-5-ylphenoxy)methyl]-4,6-diiodophenol (PubChem CID 166037499) has the molecular formula C25H17I2O2S+ and a molecular weight of 635.28 g/mol. Its IUPAC name is 2-[(4-dibenzothiophen-5-ium-5-ylphenoxy)methyl]-4,6-diiodophenol.
| Compound Name | 2-[(4-dibenzothiophen-5-ium-5-ylphenoxy)methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 166037499 |
| Molecular Formula | C25H17I2O2S+ |
| Molecular Weight | 635.28 g/mol |
| Exact Mass | 634.90 |
| IUPAC Name | 2-[(4-dibenzothiophen-5-ium-5-ylphenoxy)methyl]-4,6-diiodophenol |
| SMILES | Oc1c(I)cc(I)cc1COc1ccc(-[s+]2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C25H16I2O2S/c26-17-13-16(25(28)22(27)14-17)15-29-18-9-11-19(12-10-18)30-23-7-3-1-5-20(23)21-6-2-4-8-24(21)30/h1-14H,15H2/p+1 |
| InChIKey | TXFUPLPQGPAPIM-UHFFFAOYSA-O |
| XLogP | 8.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.28 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|