C27H17F6I2O2S+ — CID 165155241
[4-[(2-hydroxy-3,5-diiodophenyl)methoxy]phenyl]-bis[4-(trifluoromethyl)phenyl]sulfanium (PubChem CID 165155241) has the molecular formula C27H17F6I2O2S+ and a molecular weight of 773.29 g/mol. Its IUPAC name is [4-[(2-hydroxy-3,5-diiodophenyl)methoxy]phenyl]-bis[4-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | [4-[(2-hydroxy-3,5-diiodophenyl)methoxy]phenyl]-bis[4-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 165155241 |
| Molecular Formula | C27H17F6I2O2S+ |
| Molecular Weight | 773.29 g/mol |
| Exact Mass | 772.89 |
| IUPAC Name | [4-[(2-hydroxy-3,5-diiodophenyl)methoxy]phenyl]-bis[4-(trifluoromethyl)phenyl]sulfanium |
| SMILES | Oc1c(I)cc(I)cc1COc1ccc([S+](c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H16F6I2O2S/c28-26(29,30)17-1-7-21(8-2-17)38(22-9-3-18(4-10-22)27(31,32)33)23-11-5-20(6-12-23)37-15-16-13-19(34)14-24(35)25(16)36/h1-14H,15H2/p+1 |
| InChIKey | UHRGLEJIQPUREG-UHFFFAOYSA-O |
| XLogP | 9.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.29 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|