C78H81I6O12S+ — CID 169076981
tris[4-[[3,5-diiodo-2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]sulfanium (PubChem CID 169076981) has the molecular formula C78H81I6O12S+ and a molecular weight of 2003.99 g/mol. Its IUPAC name is tris[4-[[3,5-diiodo-2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]sulfanium.
| Compound Name | tris[4-[[3,5-diiodo-2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 169076981 |
| Molecular Formula | C78H81I6O12S+ |
| Molecular Weight | 2003.99 g/mol |
| Exact Mass | 2002.97 |
| IUPAC Name | tris[4-[[3,5-diiodo-2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]sulfanium |
| SMILES | CC1(OC(=O)COc2c(I)cc(I)cc2COc2ccc([S+](c3ccc(OCc4cc(I)cc(I)c4OCC(=O)OC4(C)C5CC6CC(C5)CC4C6)cc3)c3ccc(OCc4cc(I)cc(I)c4OCC(=O)OC4(C)C5CC6CC(C5)CC4C6)cc3)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C78H81I6O12S/c1-76(52-19-43-16-44(21-52)22-53(76)20-43)94-70(85)40-91-73-49(31-58(79)34-67(73)82)37-88-61-4-10-64(11-5-61)97(65-12-6-62(7-13-65)89-38-50-32-59(80)35-68(83)74(50)92-41-71(86)95-77(2)54-23-45-17-46(25-54)26-55(77)24-45)66-14-8-63(9-15-66)90-39-51-33-60(81)36-69(84)75(51)93-42-72(87)96-78(3)56-27-47-18-48(29-56)30-57(78)28-47/h4-15,31-36,43-48,52-57H,16-30,37-42H2,1-3H3/q+1 |
| InChIKey | PMOYSKWWNNGFAM-UHFFFAOYSA-N |
| XLogP | 19.56 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 97 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2003.99 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|