C39H41O5S+ — CID 166021523
[4-methoxy-3-[[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium (PubChem CID 166021523) has the molecular formula C39H41O5S+ and a molecular weight of 621.82 g/mol. Its IUPAC name is [4-methoxy-3-[[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-methoxy-3-[[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 166021523 |
| Molecular Formula | C39H41O5S+ |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | [4-methoxy-3-[[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium |
| SMILES | COc1ccc([S+](c2ccccc2)c2ccccc2)cc1OCc1ccc(OCC(=O)OC2(C)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C39H41O5S/c1-39(30-20-28-19-29(22-30)23-31(39)21-28)44-38(40)26-42-32-15-13-27(14-16-32)25-43-37-24-35(17-18-36(37)41-2)45(33-9-5-3-6-10-33)34-11-7-4-8-12-34/h3-18,24,28-31H,19-23,25-26H2,1-2H3/q+1 |
| InChIKey | SCOCVISMOVZNEC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|