C44H50Cl2O6Te — CID 154612816
(2-methyl-2-adamantyl) 2-[4-[dichloro-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-3-phenylphenyl]-λ4-tellanyl]phenoxy]acetate (PubChem CID 154612816) has the molecular formula C44H50Cl2O6Te and a molecular weight of 873.38 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[4-[dichloro-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-3-phenylphenyl]-λ4-tellanyl]phenoxy]acetate.
| Compound Name | (2-methyl-2-adamantyl) 2-[4-[dichloro-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-3-phenylphenyl]-λ4-tellanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 154612816 |
| Molecular Formula | C44H50Cl2O6Te |
| Molecular Weight | 873.38 g/mol |
| Exact Mass | 874.20 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[4-[dichloro-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-3-phenylphenyl]-λ4-tellanyl]phenoxy]acetate |
| SMILES | CC1(OC(=O)COc2ccc([Te](Cl)(Cl)c3ccc(OCC(=O)OC4(C)C5CC6CC(C5)CC4C6)c(-c4ccccc4)c3)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C44H50Cl2O6Te/c1-43(32-16-27-14-28(18-32)19-33(43)17-27)51-41(47)25-49-36-8-10-37(11-9-36)53(45,46)38-12-13-40(39(24-38)31-6-4-3-5-7-31)50-26-42(48)52-44(2)34-20-29-15-30(22-34)23-35(44)21-29/h3-13,24,27-30,32-35H,14-23,25-26H2,1-2H3 |
| InChIKey | LDBMBQINERGMRM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.38 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|