C50H54IO6S2+ — CID 162490159
bis[4-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]sulfanylphenyl]iodanium (PubChem CID 162490159) has the molecular formula C50H54IO6S2+ and a molecular weight of 942.01 g/mol. Its IUPAC name is bis[4-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]sulfanylphenyl]iodanium.
| Compound Name | bis[4-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]sulfanylphenyl]iodanium |
|---|---|
| PubChem CID | 162490159 |
| Molecular Formula | C50H54IO6S2+ |
| Molecular Weight | 942.01 g/mol |
| Exact Mass | 941.24 |
| IUPAC Name | bis[4-[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]sulfanylphenyl]iodanium |
| SMILES | CC1(OC(=O)COc2ccc(Sc3ccc([I+]c4ccc(Sc5ccc(OCC(=O)OC6(C)C7CC8CC(C7)CC6C8)cc5)cc4)cc3)cc2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C50H54IO6S2/c1-49(35-21-31-19-32(23-35)24-36(49)22-31)56-47(52)29-54-41-7-15-45(16-8-41)58-43-11-3-39(4-12-43)51-40-5-13-44(14-6-40)59-46-17-9-42(10-18-46)55-30-48(53)57-50(2)37-25-33-20-34(27-37)28-38(50)26-33/h3-18,31-38H,19-30H2,1-2H3/q+1 |
| InChIKey | SUOFGVBYDAFHRI-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.01 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|