C21H26O3 — CID 59227049
(2-methyl-2-adamantyl) 2-(4-ethenylphenoxy)acetate (PubChem CID 59227049) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-(4-ethenylphenoxy)acetate.
| Compound Name | (2-methyl-2-adamantyl) 2-(4-ethenylphenoxy)acetate |
|---|---|
| PubChem CID | 59227049 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-(4-ethenylphenoxy)acetate |
| SMILES | C=Cc1ccc(OCC(=O)OC2(C)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C21H26O3/c1-3-14-4-6-19(7-5-14)23-13-20(22)24-21(2)17-9-15-8-16(11-17)12-18(21)10-15/h3-7,15-18H,1,8-13H2,2H3 |
| InChIKey | LFGPTUGSNWXKTO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |