C23H29IO4 — CID 169322082
(2-methyl-2-adamantyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate (PubChem CID 169322082) has the molecular formula C23H29IO4 and a molecular weight of 496.39 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate.
| Compound Name | (2-methyl-2-adamantyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate |
|---|---|
| PubChem CID | 169322082 |
| Molecular Formula | C23H29IO4 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate |
| SMILES | C=Cc1cc(I)c(OCC(=O)OC2(C)C3CC4CC(C3)CC2C4)c(OCC)c1 |
| InChI | InChI=1S/C23H29IO4/c1-4-14-11-19(24)22(20(12-14)26-5-2)27-13-21(25)28-23(3)17-7-15-6-16(9-17)10-18(23)8-15/h4,11-12,15-18H,1,5-10,13H2,2-3H3 |
| InChIKey | HATHVEMFJYYDSI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|