C22H31IO4 — CID 174348689
(1-tert-butylcyclohexyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate (PubChem CID 174348689) has the molecular formula C22H31IO4 and a molecular weight of 486.39 g/mol. Its IUPAC name is (1-tert-butylcyclohexyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate.
| Compound Name | (1-tert-butylcyclohexyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate |
|---|---|
| PubChem CID | 174348689 |
| Molecular Formula | C22H31IO4 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (1-tert-butylcyclohexyl) 2-(4-ethenyl-2-ethoxy-6-iodophenoxy)acetate |
| SMILES | C=Cc1cc(I)c(OCC(=O)OC2(C(C)(C)C)CCCCC2)c(OCC)c1 |
| InChI | InChI=1S/C22H31IO4/c1-6-16-13-17(23)20(18(14-16)25-7-2)26-15-19(24)27-22(21(3,4)5)11-9-8-10-12-22/h6,13-14H,1,7-12,15H2,2-5H3 |
| InChIKey | IADSZPWKAZSFCS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|