C38H38IO4S+ — CID 166021497
[4-[[3-iodo-4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium (PubChem CID 166021497) has the molecular formula C38H38IO4S+ and a molecular weight of 717.69 g/mol. Its IUPAC name is [4-[[3-iodo-4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[[3-iodo-4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 166021497 |
| Molecular Formula | C38H38IO4S+ |
| Molecular Weight | 717.69 g/mol |
| Exact Mass | 717.15 |
| IUPAC Name | [4-[[3-iodo-4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]phenyl]methoxy]phenyl]-diphenylsulfanium |
| SMILES | CC1(OC(=O)COc2ccc(COc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2I)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C38H38IO4S/c1-38(29-19-27-18-28(21-29)22-30(38)20-27)43-37(40)25-42-36-17-12-26(23-35(36)39)24-41-31-13-15-34(16-14-31)44(32-8-4-2-5-9-32)33-10-6-3-7-11-33/h2-17,23,27-30H,18-22,24-25H2,1H3/q+1 |
| InChIKey | VLGPJMVZBCJHGQ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|