C21H17F3IOS+ — CID 143507699
[4-(iodomethyl)phenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium (PubChem CID 143507699) has the molecular formula C21H17F3IOS+ and a molecular weight of 501.33 g/mol. Its IUPAC name is [4-(iodomethyl)phenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | [4-(iodomethyl)phenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 143507699 |
| Molecular Formula | C21H17F3IOS+ |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | [4-(iodomethyl)phenyl]-(4-methoxyphenyl)-[4-(trifluoromethyl)phenyl]sulfanium |
| SMILES | COc1ccc([S+](c2ccc(CI)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H17F3IOS/c1-26-17-6-12-20(13-7-17)27(18-8-2-15(14-25)3-9-18)19-10-4-16(5-11-19)21(22,23)24/h2-13H,14H2,1H3/q+1 |
| InChIKey | KNTQDXDYFZOKPI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|