C18H17F3O — CID 154713677
1-methoxy-4-[(2R)-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene (PubChem CID 154713677) has the molecular formula C18H17F3O and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-methoxy-4-[(2R)-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene.
| Compound Name | 1-methoxy-4-[(2R)-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene |
|---|---|
| PubChem CID | 154713677 |
| Molecular Formula | C18H17F3O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-methoxy-4-[(2R)-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene |
| SMILES | C=C[C@@H](Cc1ccc(OC)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O/c1-3-14(12-13-4-10-17(22-2)11-5-13)15-6-8-16(9-7-15)18(19,20)21/h3-11,14H,1,12H2,2H3/t14-/m0/s1 |
| InChIKey | ZMRKHDUYXNDYRV-AWEZNQCLSA-N |
| XLogP | 5.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|