C18H11I2S+ — CID 176607373
5-(3,5-diiodophenyl)dibenzothiophen-5-ium (PubChem CID 176607373) has the molecular formula C18H11I2S+ and a molecular weight of 513.16 g/mol. Its IUPAC name is 5-(3,5-diiodophenyl)dibenzothiophen-5-ium.
| Compound Name | 5-(3,5-diiodophenyl)dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 176607373 |
| Molecular Formula | C18H11I2S+ |
| Molecular Weight | 513.16 g/mol |
| Exact Mass | 512.87 |
| IUPAC Name | 5-(3,5-diiodophenyl)dibenzothiophen-5-ium |
| SMILES | Ic1cc(I)cc(-[s+]2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C18H11I2S/c19-12-9-13(20)11-14(10-12)21-17-7-3-1-5-15(17)16-6-2-4-8-18(16)21/h1-11H/q+1 |
| InChIKey | IWRBIYGFOVLWJM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.16 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|