About (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate
(3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate (PubChem CID 147715188) has the molecular formula C25H14I3O2S+
and a molecular weight of 759.16 g/mol. Its IUPAC name is (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate.
Molecular Properties
| Compound Name | (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate |
| PubChem CID | 147715188 |
| Molecular Formula | C25H14I3O2S+ |
| Molecular Weight | 759.16 g/mol |
| Exact Mass | 758.78 |
| IUPAC Name | (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate |
| SMILES | O=C(Oc1cccc(-[s+]2c3ccccc3c3ccccc32)c1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C25H14I3O2S/c26-19-12-13-20(27)24(28)23(19)25(29)30-15-6-5-7-16(14-15)31-21-10-3-1-8-17(21)18-9-2-4-11-22(18)31/h1-14H/q+1 |
| InChIKey | GVMHUQSRMGMLGZ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 759.16 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate?
The IUPAC name of (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate (CID 147715188) is (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate.
What is the SMILES notation for (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate?
The canonical SMILES for (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate is O=C(Oc1cccc(-[s+]2c3ccccc3c3ccccc32)c1)c1c(I)ccc(I)c1I.
What is the InChIKey of (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate?
The InChIKey is GVMHUQSRMGMLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14I3O2S/c26-19-12-13-20(27)24(28)23(19)25(29)30-15-6-5-7-16(14-15)31-21-10-3-1-8-17(21)18-9-2-4-11-22(18)31/h1-14H/q+1.
What are the key properties of (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate?
(3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate has a molecular weight of 759.16 g/mol, XLogP of 8.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-dibenzothiophen-5-ium-5-ylphenyl) 2,3,6-triiodobenzoate is sourced from PubChem (CID 147715188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).