C51H30I6N2O4S2+2 — CID 166851237
[4-[2-[10-methyl-5-[4-(2,3,6-triiodobenzoyl)oxyphenyl]phenothiazin-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]phenyl] 2,3,6-triiodobenzoate (PubChem CID 166851237) has the molecular formula C51H30I6N2O4S2+2 and a molecular weight of 1560.37 g/mol. Its IUPAC name is [4-[2-[10-methyl-5-[4-(2,3,6-triiodobenzoyl)oxyphenyl]phenothiazin-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]phenyl] 2,3,6-triiodobenzoate.
| Compound Name | [4-[2-[10-methyl-5-[4-(2,3,6-triiodobenzoyl)oxyphenyl]phenothiazin-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]phenyl] 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 166851237 |
| Molecular Formula | C51H30I6N2O4S2+2 |
| Molecular Weight | 1560.37 g/mol |
| Exact Mass | 1559.59 |
| IUPAC Name | [4-[2-[10-methyl-5-[4-(2,3,6-triiodobenzoyl)oxyphenyl]phenothiazin-5-ium-2-yl]-10H-phenothiazin-5-ium-5-yl]phenyl] 2,3,6-triiodobenzoate |
| SMILES | CN1c2ccccc2[S+](c2ccc(OC(=O)c3c(I)ccc(I)c3I)cc2)c2ccc(-c3ccc4c(c3)Nc3ccccc3[S+]4c3ccc(OC(=O)c4c(I)ccc(I)c4I)cc3)cc21 |
| InChI | InChI=1S/C51H30I6N2O4S2/c1-59-40-7-3-5-9-44(40)65(33-18-14-31(15-19-33)63-51(61)47-35(53)21-23-37(55)49(47)57)45-25-11-29(27-41(45)59)28-10-24-43-39(26-28)58-38-6-2-4-8-42(38)64(43)32-16-12-30(13-17-32)62-50(60)46-34(52)20-22-36(54)48(46)56/h2-27,58H,1H3/q+2 |
| InChIKey | RJWSZFWSZUPXNK-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1560.37 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|