C50H29I6NO5S2+2 — CID 166841080
(2,4,6-triiodophenyl) 4-[2-[5-[4-[hydroxy-(2,4,6-triiodophenoxy)methyl]phenyl]-10H-phenothiazin-5-ium-3-yl]phenoxathiin-10-ium-10-yl]benzoate (PubChem CID 166841080) has the molecular formula C50H29I6NO5S2+2 and a molecular weight of 1549.34 g/mol. Its IUPAC name is (2,4,6-triiodophenyl) 4-[2-[5-[4-[hydroxy-(2,4,6-triiodophenoxy)methyl]phenyl]-10H-phenothiazin-5-ium-3-yl]phenoxathiin-10-ium-10-yl]benzoate.
| Compound Name | (2,4,6-triiodophenyl) 4-[2-[5-[4-[hydroxy-(2,4,6-triiodophenoxy)methyl]phenyl]-10H-phenothiazin-5-ium-3-yl]phenoxathiin-10-ium-10-yl]benzoate |
|---|---|
| PubChem CID | 166841080 |
| Molecular Formula | C50H29I6NO5S2+2 |
| Molecular Weight | 1549.34 g/mol |
| Exact Mass | 1548.57 |
| IUPAC Name | (2,4,6-triiodophenyl) 4-[2-[5-[4-[hydroxy-(2,4,6-triiodophenoxy)methyl]phenyl]-10H-phenothiazin-5-ium-3-yl]phenoxathiin-10-ium-10-yl]benzoate |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc([S+]2c3ccccc3Oc3ccc(-c4ccc5c(c4)[S+](c4ccc(C(O)Oc6c(I)cc(I)cc6I)cc4)c4ccccc4N5)cc32)cc1 |
| InChI | InChI=1S/C50H29I6NO5S2/c51-31-23-35(53)47(36(54)24-31)61-49(58)27-9-15-33(16-10-27)63-43-7-3-1-5-39(43)57-40-19-13-29(21-45(40)63)30-14-20-42-46(22-30)64(44-8-4-2-6-41(44)60-42)34-17-11-28(12-18-34)50(59)62-48-37(55)25-32(52)26-38(48)56/h1-26,49,57-58H/q+2 |
| InChIKey | HYHKIXDRDVXYHM-UHFFFAOYSA-N |
| XLogP | 15.62 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1549.34 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|