C28H21I3NO3S+ — CID 153464214
[4-[3-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxyphenyl]-diphenylsulfanium (PubChem CID 153464214) has the molecular formula C28H21I3NO3S+ and a molecular weight of 832.26 g/mol. Its IUPAC name is [4-[3-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxyphenyl]-diphenylsulfanium.
| Compound Name | [4-[3-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxyphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 153464214 |
| Molecular Formula | C28H21I3NO3S+ |
| Molecular Weight | 832.26 g/mol |
| Exact Mass | 831.84 |
| IUPAC Name | [4-[3-[acetyl(methyl)amino]-2,4,6-triiodobenzoyl]oxyphenyl]-diphenylsulfanium |
| SMILES | CC(=O)N(C)c1c(I)cc(I)c(C(=O)Oc2ccc([S+](c3ccccc3)c3ccccc3)cc2)c1I |
| InChI | InChI=1S/C28H21I3NO3S/c1-18(33)32(2)27-24(30)17-23(29)25(26(27)31)28(34)35-19-13-15-22(16-14-19)36(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17H,1-2H3/q+1 |
| InChIKey | GSGREQFPGJBVCI-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.26 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|